C13H12F3NO3 — CID 43752900
7-(3-amino-1,1,1-trifluoropropan-2-yl)oxy-4-methylchromen-2-one (PubChem CID 43752900) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 7-(3-amino-1,1,1-trifluoropropan-2-yl)oxy-4-methylchromen-2-one.
| Compound Name | 7-(3-amino-1,1,1-trifluoropropan-2-yl)oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 43752900 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 7-(3-amino-1,1,1-trifluoropropan-2-yl)oxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OC(CN)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C13H12F3NO3/c1-7-4-12(18)20-10-5-8(2-3-9(7)10)19-11(6-17)13(14,15)16/h2-5,11H,6,17H2,1H3 |
| InChIKey | GTICSMSJVQIQDS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|