C16H13Cl2NO2 — CID 43757157
2,5-dichloro-N-[(7-methoxy-1-benzofuran-2-yl)methyl]aniline (PubChem CID 43757157) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is 2,5-dichloro-N-[(7-methoxy-1-benzofuran-2-yl)methyl]aniline.
| Compound Name | 2,5-dichloro-N-[(7-methoxy-1-benzofuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 43757157 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2,5-dichloro-N-[(7-methoxy-1-benzofuran-2-yl)methyl]aniline |
| SMILES | COc1cccc2cc(CNc3cc(Cl)ccc3Cl)oc12 |
| InChI | InChI=1S/C16H13Cl2NO2/c1-20-15-4-2-3-10-7-12(21-16(10)15)9-19-14-8-11(17)5-6-13(14)18/h2-8,19H,9H2,1H3 |
| InChIKey | QKNWQSHJNINYDY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |