C15H11Cl2NS2 — CID 43757202
2,5-dichloro-N-(dithiophen-2-ylmethyl)aniline (PubChem CID 43757202) has the molecular formula C15H11Cl2NS2 and a molecular weight of 340.30 g/mol. Its IUPAC name is 2,5-dichloro-N-(dithiophen-2-ylmethyl)aniline.
| Compound Name | 2,5-dichloro-N-(dithiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 43757202 |
| Molecular Formula | C15H11Cl2NS2 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 2,5-dichloro-N-(dithiophen-2-ylmethyl)aniline |
| SMILES | Clc1ccc(Cl)c(NC(c2cccs2)c2cccs2)c1 |
| InChI | InChI=1S/C15H11Cl2NS2/c16-10-5-6-11(17)12(9-10)18-15(13-3-1-7-19-13)14-4-2-8-20-14/h1-9,15,18H |
| InChIKey | JKYXASFXXBQJFJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |