C15H10Cl3NS2 — CID 43773694
2,4,6-trichloro-N-(dithiophen-2-ylmethyl)aniline (PubChem CID 43773694) has the molecular formula C15H10Cl3NS2 and a molecular weight of 374.75 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(dithiophen-2-ylmethyl)aniline.
| Compound Name | 2,4,6-trichloro-N-(dithiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 43773694 |
| Molecular Formula | C15H10Cl3NS2 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 2,4,6-trichloro-N-(dithiophen-2-ylmethyl)aniline |
| SMILES | Clc1cc(Cl)c(NC(c2cccs2)c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl3NS2/c16-9-7-10(17)14(11(18)8-9)19-15(12-3-1-5-20-12)13-4-2-6-21-13/h1-8,15,19H |
| InChIKey | KOSNZVZXYORTMU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |