C17H17NOS2 — CID 106953646
4-(dithiophen-2-ylmethylamino)-2,5-dimethylphenol (PubChem CID 106953646) has the molecular formula C17H17NOS2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-(dithiophen-2-ylmethylamino)-2,5-dimethylphenol.
| Compound Name | 4-(dithiophen-2-ylmethylamino)-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953646 |
| Molecular Formula | C17H17NOS2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-(dithiophen-2-ylmethylamino)-2,5-dimethylphenol |
| SMILES | Cc1cc(NC(c2cccs2)c2cccs2)c(C)cc1O |
| InChI | InChI=1S/C17H17NOS2/c1-11-10-14(19)12(2)9-13(11)18-17(15-5-3-7-20-15)16-6-4-8-21-16/h3-10,17-19H,1-2H3 |
| InChIKey | CIKKMTRPTKPGDV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|