C18H21NS — CID 43757286
N-[cyclopropyl-(4-methylphenyl)methyl]-3-methylsulfanylaniline (PubChem CID 43757286) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methylphenyl)methyl]-3-methylsulfanylaniline.
| Compound Name | N-[cyclopropyl-(4-methylphenyl)methyl]-3-methylsulfanylaniline |
|---|---|
| PubChem CID | 43757286 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[cyclopropyl-(4-methylphenyl)methyl]-3-methylsulfanylaniline |
| SMILES | CSc1cccc(NC(c2ccc(C)cc2)C2CC2)c1 |
| InChI | InChI=1S/C18H21NS/c1-13-6-8-14(9-7-13)18(15-10-11-15)19-16-4-3-5-17(12-16)20-2/h3-9,12,15,18-19H,10-11H2,1-2H3 |
| InChIKey | RZCZRCIOICLXKO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |