C17H18FNOS — CID 43758238
N-(2-ethoxyphenyl)-8-fluoro-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43758238) has the molecular formula C17H18FNOS and a molecular weight of 303.40 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-8-fluoro-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-(2-ethoxyphenyl)-8-fluoro-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43758238 |
| Molecular Formula | C17H18FNOS |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(2-ethoxyphenyl)-8-fluoro-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCOc1ccccc1NC1CCSc2c(F)cccc21 |
| InChI | InChI=1S/C17H18FNOS/c1-2-20-16-9-4-3-8-15(16)19-14-10-11-21-17-12(14)6-5-7-13(17)18/h3-9,14,19H,2,10-11H2,1H3 |
| InChIKey | LFVVLVGBJMQKIW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |