C16H16ClN3O — CID 43758634
3-chloro-2-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline (PubChem CID 43758634) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline.
| Compound Name | 3-chloro-2-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 43758634 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-chloro-2-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline |
| SMILES | Cc1ccc(-c2[nH]ncc2CNc2cccc(Cl)c2C)o1 |
| InChI | InChI=1S/C16H16ClN3O/c1-10-6-7-15(21-10)16-12(9-19-20-16)8-18-14-5-3-4-13(17)11(14)2/h3-7,9,18H,8H2,1-2H3,(H,19,20) |
| InChIKey | AIWCVOJUYNIXJV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |