C15H13ClFN3O — CID 43774028
2-chloro-4-fluoro-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline (PubChem CID 43774028) has the molecular formula C15H13ClFN3O and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline.
| Compound Name | 2-chloro-4-fluoro-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 43774028 |
| Molecular Formula | C15H13ClFN3O |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-chloro-4-fluoro-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]aniline |
| SMILES | Cc1ccc(-c2[nH]ncc2CNc2ccc(F)cc2Cl)o1 |
| InChI | InChI=1S/C15H13ClFN3O/c1-9-2-5-14(21-9)15-10(8-19-20-15)7-18-13-4-3-11(17)6-12(13)16/h2-6,8,18H,7H2,1H3,(H,19,20) |
| InChIKey | XNFNBQOBCQTXBA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |