C19H34N2 — CID 43758913
N,N,2,2-tetramethyl-N'-(1-phenylhexyl)propane-1,3-diamine (PubChem CID 43758913) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-(1-phenylhexyl)propane-1,3-diamine.
| Compound Name | N,N,2,2-tetramethyl-N'-(1-phenylhexyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 43758913 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-(1-phenylhexyl)propane-1,3-diamine |
| SMILES | CCCCCC(NCC(C)(C)CN(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H34N2/c1-6-7-9-14-18(17-12-10-8-11-13-17)20-15-19(2,3)16-21(4)5/h8,10-13,18,20H,6-7,9,14-16H2,1-5H3 |
| InChIKey | IMEVIMHXOUYFCN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|