C15H10F3NS2 — CID 43759563
2,3,4-trifluoro-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]aniline (PubChem CID 43759563) has the molecular formula C15H10F3NS2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]aniline.
| Compound Name | 2,3,4-trifluoro-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 43759563 |
| Molecular Formula | C15H10F3NS2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2,3,4-trifluoro-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]aniline |
| SMILES | Fc1ccc(NCc2cc(-c3cccs3)cs2)c(F)c1F |
| InChI | InChI=1S/C15H10F3NS2/c16-11-3-4-12(15(18)14(11)17)19-7-10-6-9(8-21-10)13-2-1-5-20-13/h1-6,8,19H,7H2 |
| InChIKey | WQEAUWIWAVBFMS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|