C17H18N2S2 — CID 43778754
4-N,4-N-dimethyl-1-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]benzene-1,4-diamine (PubChem CID 43778754) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 43778754 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NCc2cc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C17H18N2S2/c1-19(2)15-7-5-14(6-8-15)18-11-16-10-13(12-21-16)17-4-3-9-20-17/h3-10,12,18H,11H2,1-2H3 |
| InChIKey | QEYMSDKUXRCRAJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|