C17H15NOS2 — CID 43788599
N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 43788599) has the molecular formula C17H15NOS2 and a molecular weight of 313.45 g/mol. Its IUPAC name is N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 43788599 |
| Molecular Formula | C17H15NOS2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | c1csc(-c2csc(CNc3ccc4c(c3)CCO4)c2)c1 |
| InChI | InChI=1S/C17H15NOS2/c1-2-17(20-7-1)13-9-15(21-11-13)10-18-14-3-4-16-12(8-14)5-6-19-16/h1-4,7-9,11,18H,5-6,10H2 |
| InChIKey | OXKICYSNUAVJIM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|