C14H15BrClNO2S — CID 43760286
N-[1-(3-bromothiophen-2-yl)ethyl]-5-chloro-2,4-dimethoxyaniline (PubChem CID 43760286) has the molecular formula C14H15BrClNO2S and a molecular weight of 376.70 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)ethyl]-5-chloro-2,4-dimethoxyaniline.
| Compound Name | N-[1-(3-bromothiophen-2-yl)ethyl]-5-chloro-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 43760286 |
| Molecular Formula | C14H15BrClNO2S |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)ethyl]-5-chloro-2,4-dimethoxyaniline |
| SMILES | COc1cc(OC)c(NC(C)c2sccc2Br)cc1Cl |
| InChI | InChI=1S/C14H15BrClNO2S/c1-8(14-9(15)4-5-20-14)17-11-6-10(16)12(18-2)7-13(11)19-3/h4-8,17H,1-3H3 |
| InChIKey | CQKYBARFAHJQCF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|