C18H21NO — CID 43765631
2,3-dimethyl-N-[(2-prop-2-enoxyphenyl)methyl]aniline (PubChem CID 43765631) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(2-prop-2-enoxyphenyl)methyl]aniline.
| Compound Name | 2,3-dimethyl-N-[(2-prop-2-enoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 43765631 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2,3-dimethyl-N-[(2-prop-2-enoxyphenyl)methyl]aniline |
| SMILES | C=CCOc1ccccc1CNc1cccc(C)c1C |
| InChI | InChI=1S/C18H21NO/c1-4-12-20-18-11-6-5-9-16(18)13-19-17-10-7-8-14(2)15(17)3/h4-11,19H,1,12-13H2,2-3H3 |
| InChIKey | JSCORDDAZNJANZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|