C18H23IN2 — CID 43768392
N-[1-(4-iodophenyl)ethyl]-N',N'-dimethyl-1-phenylethane-1,2-diamine (PubChem CID 43768392) has the molecular formula C18H23IN2 and a molecular weight of 394.30 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)ethyl]-N',N'-dimethyl-1-phenylethane-1,2-diamine.
| Compound Name | N-[1-(4-iodophenyl)ethyl]-N',N'-dimethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 43768392 |
| Molecular Formula | C18H23IN2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[1-(4-iodophenyl)ethyl]-N',N'-dimethyl-1-phenylethane-1,2-diamine |
| SMILES | CC(NC(CN(C)C)c1ccccc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H23IN2/c1-14(15-9-11-17(19)12-10-15)20-18(13-21(2)3)16-7-5-4-6-8-16/h4-12,14,18,20H,13H2,1-3H3 |
| InChIKey | NQRRVGVSZFOAIH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|