C15H25IN2 — CID 54953620
2-N-[1-(4-iodophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine (PubChem CID 54953620) has the molecular formula C15H25IN2 and a molecular weight of 360.28 g/mol. Its IUPAC name is 2-N-[1-(4-iodophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine.
| Compound Name | 2-N-[1-(4-iodophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 54953620 |
| Molecular Formula | C15H25IN2 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-N-[1-(4-iodophenyl)ethyl]-1-N,1-N,3-trimethylbutane-1,2-diamine |
| SMILES | CC(NC(CN(C)C)C(C)C)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H25IN2/c1-11(2)15(10-18(4)5)17-12(3)13-6-8-14(16)9-7-13/h6-9,11-12,15,17H,10H2,1-5H3 |
| InChIKey | JYHSMFNLLXFUAU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|