C18H20FN — CID 43768785
1-cyclopropyl-1-(4-fluorophenyl)-N-[(3-methylphenyl)methyl]methanamine (PubChem CID 43768785) has the molecular formula C18H20FN and a molecular weight of 269.36 g/mol. Its IUPAC name is 1-cyclopropyl-1-(4-fluorophenyl)-N-[(3-methylphenyl)methyl]methanamine.
| Compound Name | 1-cyclopropyl-1-(4-fluorophenyl)-N-[(3-methylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 43768785 |
| Molecular Formula | C18H20FN |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-cyclopropyl-1-(4-fluorophenyl)-N-[(3-methylphenyl)methyl]methanamine |
| SMILES | Cc1cccc(CNC(c2ccc(F)cc2)C2CC2)c1 |
| InChI | InChI=1S/C18H20FN/c1-13-3-2-4-14(11-13)12-20-18(15-5-6-15)16-7-9-17(19)10-8-16/h2-4,7-11,15,18,20H,5-6,12H2,1H3 |
| InChIKey | IUYZVEXXKKEPMW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |