C17H16BrF2N — CID 61015900
N-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-(4-fluorophenyl)methanamine (PubChem CID 61015900) has the molecular formula C17H16BrF2N and a molecular weight of 352.22 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-(4-fluorophenyl)methanamine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-(4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 61015900 |
| Molecular Formula | C17H16BrF2N |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-(4-fluorophenyl)methanamine |
| SMILES | Fc1ccc(C(NCc2cc(F)ccc2Br)C2CC2)cc1 |
| InChI | InChI=1S/C17H16BrF2N/c18-16-8-7-15(20)9-13(16)10-21-17(11-1-2-11)12-3-5-14(19)6-4-12/h3-9,11,17,21H,1-2,10H2 |
| InChIKey | YGXINOOVRHSULN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |