C17H16BrClFN — CID 60658432
N-[(5-bromo-2-fluorophenyl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine (PubChem CID 60658432) has the molecular formula C17H16BrClFN and a molecular weight of 368.68 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine |
|---|---|
| PubChem CID | 60658432 |
| Molecular Formula | C17H16BrClFN |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine |
| SMILES | Fc1ccc(Br)cc1CNC(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C17H16BrClFN/c18-14-5-8-16(20)13(9-14)10-21-17(11-1-2-11)12-3-6-15(19)7-4-12/h3-9,11,17,21H,1-2,10H2 |
| InChIKey | BPUOEERIAYUIKN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |