C15H15BrClNS — CID 78974964
N-[(3-bromothiophen-2-yl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine (PubChem CID 78974964) has the molecular formula C15H15BrClNS and a molecular weight of 356.72 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine |
|---|---|
| PubChem CID | 78974964 |
| Molecular Formula | C15H15BrClNS |
| Molecular Weight | 356.72 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-1-(4-chlorophenyl)-1-cyclopropylmethanamine |
| SMILES | Clc1ccc(C(NCc2sccc2Br)C2CC2)cc1 |
| InChI | InChI=1S/C15H15BrClNS/c16-13-7-8-19-14(13)9-18-15(10-1-2-10)11-3-5-12(17)6-4-11/h3-8,10,15,18H,1-2,9H2 |
| InChIKey | BMZIKHXPPJGNDN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |