C16H24N2OS — CID 43769539
N-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 43769539) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | N-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 43769539 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | c1ccc2c(c1)CSCC2NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H24N2OS/c1-2-5-15-14(4-1)12-20-13-16(15)17-6-3-7-18-8-10-19-11-9-18/h1-2,4-5,16-17H,3,6-13H2 |
| InChIKey | TVPPLRAWBGUVQH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|