C15H21NOS — CID 55227965
N-(oxan-4-ylmethyl)-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 55227965) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is N-(oxan-4-ylmethyl)-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | N-(oxan-4-ylmethyl)-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 55227965 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(oxan-4-ylmethyl)-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | c1ccc2c(c1)CSCC2NCC1CCOCC1 |
| InChI | InChI=1S/C15H21NOS/c1-2-4-14-13(3-1)10-18-11-15(14)16-9-12-5-7-17-8-6-12/h1-4,12,15-16H,5-11H2 |
| InChIKey | FEPNGDMNJXSCGT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |