C15H23NS — CID 115718050
N-(2-ethylbutyl)-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 115718050) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is N-(2-ethylbutyl)-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | N-(2-ethylbutyl)-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 115718050 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-(2-ethylbutyl)-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CCC(CC)CNC1CSCc2ccccc21 |
| InChI | InChI=1S/C15H23NS/c1-3-12(4-2)9-16-15-11-17-10-13-7-5-6-8-14(13)15/h5-8,12,15-16H,3-4,9-11H2,1-2H3 |
| InChIKey | SRDYOVAUMPLIKX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |