C17H19NS — CID 43764362
N-(4-ethylphenyl)-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 43764362) has the molecular formula C17H19NS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | N-(4-ethylphenyl)-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 43764362 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(4-ethylphenyl)-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CCc1ccc(NC2CSCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H19NS/c1-2-13-7-9-15(10-8-13)18-17-12-19-11-14-5-3-4-6-16(14)17/h3-10,17-18H,2,11-12H2,1H3 |
| InChIKey | YDNZGWHEBDRSQA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |