C16H17NOS — CID 43757867
N-(2-methoxyphenyl)-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 43757867) has the molecular formula C16H17NOS and a molecular weight of 271.39 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | N-(2-methoxyphenyl)-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 43757867 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(2-methoxyphenyl)-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | COc1ccccc1NC1CSCc2ccccc21 |
| InChI | InChI=1S/C16H17NOS/c1-18-16-9-5-4-8-14(16)17-15-11-19-10-12-6-2-3-7-13(12)15/h2-9,15,17H,10-11H2,1H3 |
| InChIKey | BYEVJMOHQIMEJO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |