C16H17NO2S — CID 43790748
5-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2-methoxyphenol (PubChem CID 43790748) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2-methoxyphenol.
| Compound Name | 5-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2-methoxyphenol |
|---|---|
| PubChem CID | 43790748 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2-methoxyphenol |
| SMILES | COc1ccc(NC2CSCc3ccccc32)cc1O |
| InChI | InChI=1S/C16H17NO2S/c1-19-16-7-6-12(8-15(16)18)17-14-10-20-9-11-4-2-3-5-13(11)14/h2-8,14,17-18H,9-10H2,1H3 |
| InChIKey | VSNNYOQLFSZRRL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|