C18H21NS — CID 43767150
N-(3-phenylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 43767150) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(3-phenylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | N-(3-phenylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 43767150 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(3-phenylpropyl)-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | c1ccc(CCCNC2CSCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NS/c1-2-7-15(8-3-1)9-6-12-19-18-14-20-13-16-10-4-5-11-17(16)18/h1-5,7-8,10-11,18-19H,6,9,12-14H2 |
| InChIKey | AVFRFACNXQMPLI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|