C17H21Cl2NO — CID 43769812
N-[1-(3,4-dichlorophenyl)propyl]-4-(furan-2-yl)butan-2-amine (PubChem CID 43769812) has the molecular formula C17H21Cl2NO and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)propyl]-4-(furan-2-yl)butan-2-amine.
| Compound Name | N-[1-(3,4-dichlorophenyl)propyl]-4-(furan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 43769812 |
| Molecular Formula | C17H21Cl2NO |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)propyl]-4-(furan-2-yl)butan-2-amine |
| SMILES | CCC(NC(C)CCc1ccco1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2NO/c1-3-17(13-7-9-15(18)16(19)11-13)20-12(2)6-8-14-5-4-10-21-14/h4-5,7,9-12,17,20H,3,6,8H2,1-2H3 |
| InChIKey | MIZIHPSVZAVWCQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |