C12H19NO2S — CID 43771289
3-ethenoxy-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 43771289) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-ethenoxy-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | 3-ethenoxy-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 43771289 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-ethenoxy-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | C=COCCCNCc1ccc(CSC)o1 |
| InChI | InChI=1S/C12H19NO2S/c1-3-14-8-4-7-13-9-11-5-6-12(15-11)10-16-2/h3,5-6,13H,1,4,7-10H2,2H3 |
| InChIKey | AAOBBJYWLCBSRV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|