C16H14FNS2 — CID 43773033
N-[(3-fluorophenyl)methyl]-1,1-dithiophen-2-ylmethanamine (PubChem CID 43773033) has the molecular formula C16H14FNS2 and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-1,1-dithiophen-2-ylmethanamine.
| Compound Name | N-[(3-fluorophenyl)methyl]-1,1-dithiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 43773033 |
| Molecular Formula | C16H14FNS2 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-1,1-dithiophen-2-ylmethanamine |
| SMILES | Fc1cccc(CNC(c2cccs2)c2cccs2)c1 |
| InChI | InChI=1S/C16H14FNS2/c17-13-5-1-4-12(10-13)11-18-16(14-6-2-8-19-14)15-7-3-9-20-15/h1-10,16,18H,11H2 |
| InChIKey | QDUPSYDWYLRQFL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |