C12H13N5O — CID 43776859
N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-1H-pyrazol-4-amine (PubChem CID 43776859) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-1H-pyrazol-4-amine.
| Compound Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43776859 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-1H-pyrazol-4-amine |
| SMILES | Cn1ccnc1C(Nc1cn[nH]c1)c1ccco1 |
| InChI | InChI=1S/C12H13N5O/c1-17-5-4-13-12(17)11(10-3-2-6-18-10)16-9-7-14-15-8-9/h2-8,11,16H,1H3,(H,14,15) |
| InChIKey | LMRRIJYIJYEKLI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |