C15H13Br2N3O — CID 43780865
2,4-dibromo-N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]aniline (PubChem CID 43780865) has the molecular formula C15H13Br2N3O and a molecular weight of 411.10 g/mol. Its IUPAC name is 2,4-dibromo-N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]aniline.
| Compound Name | 2,4-dibromo-N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 43780865 |
| Molecular Formula | C15H13Br2N3O |
| Molecular Weight | 411.10 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | 2,4-dibromo-N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]aniline |
| SMILES | Cn1ccnc1C(Nc1ccc(Br)cc1Br)c1ccco1 |
| InChI | InChI=1S/C15H13Br2N3O/c1-20-7-6-18-15(20)14(13-3-2-8-21-13)19-12-5-4-10(16)9-11(12)17/h2-9,14,19H,1H3 |
| InChIKey | AOEBTHMGXOGGCJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.10 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |