C12H19NO2S — CID 43778631
N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothian-4-amine (PubChem CID 43778631) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43778631 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(NC2CC3CC=CC32)CC1 |
| InChI | InChI=1S/C12H19NO2S/c14-16(15)6-4-10(5-7-16)13-12-8-9-2-1-3-11(9)12/h1,3,9-13H,2,4-8H2 |
| InChIKey | RDUJALYTBBSMOO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|