C12H19NO2S — CID 43780146
N-(6-bicyclo[3.2.0]hept-3-enyl)-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 43780146) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)-3-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-3-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43780146 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CC1(NC2CC3CC=CC32)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H19NO2S/c1-12(5-6-16(14,15)8-12)13-11-7-9-3-2-4-10(9)11/h2,4,9-11,13H,3,5-8H2,1H3 |
| InChIKey | BFNPXUIUKRWRCY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|