C14H23NO2S — CID 54915324
1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine (PubChem CID 54915324) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 54915324 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| SMILES | CC(NCC1CCS(=O)(=O)C1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H23NO2S/c1-10(14-7-11-2-3-13(14)6-11)15-8-12-4-5-18(16,17)9-12/h2-3,10-15H,4-9H2,1H3 |
| InChIKey | PXAHHEXOGDBZTH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|