C16H23NO3S — CID 43778640
N-[cyclopropyl-(4-methoxyphenyl)methyl]-1,1-dioxothian-4-amine (PubChem CID 43778640) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methoxyphenyl)methyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[cyclopropyl-(4-methoxyphenyl)methyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43778640 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[cyclopropyl-(4-methoxyphenyl)methyl]-1,1-dioxothian-4-amine |
| SMILES | COc1ccc(C(NC2CCS(=O)(=O)CC2)C2CC2)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-20-15-6-4-13(5-7-15)16(12-2-3-12)17-14-8-10-21(18,19)11-9-14/h4-7,12,14,16-17H,2-3,8-11H2,1H3 |
| InChIKey | DRANIBWBPFFGLY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |