C15H20ClNO2S — CID 43778641
N-[(4-chlorophenyl)-cyclopropylmethyl]-1,1-dioxothian-4-amine (PubChem CID 43778641) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-cyclopropylmethyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43778641 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(NC(c2ccc(Cl)cc2)C2CC2)CC1 |
| InChI | InChI=1S/C15H20ClNO2S/c16-13-5-3-12(4-6-13)15(11-1-2-11)17-14-7-9-20(18,19)10-8-14/h3-6,11,14-15,17H,1-2,7-10H2 |
| InChIKey | SQLCADUYGFLIKO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |