C19H26ClNO2 — CID 122031155
4-[[(4-chlorophenyl)-cyclopentylmethyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122031155) has the molecular formula C19H26ClNO2 and a molecular weight of 335.87 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)-cyclopentylmethyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(4-chlorophenyl)-cyclopentylmethyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122031155 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.87 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-[[(4-chlorophenyl)-cyclopentylmethyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(c2ccc(Cl)cc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C19H26ClNO2/c20-16-9-5-14(6-10-16)18(13-3-1-2-4-13)21-17-11-7-15(8-12-17)19(22)23/h5-6,9-10,13,15,17-18,21H,1-4,7-8,11-12H2,(H,22,23) |
| InChIKey | MXAIPVJQRZVLGE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |