C18H25ClN2 — CID 43791325
N-[(4-chlorophenyl)-cyclopropylmethyl]-1-cyclopropylpiperidin-4-amine (PubChem CID 43791325) has the molecular formula C18H25ClN2 and a molecular weight of 304.86 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-cyclopropylmethyl]-1-cyclopropylpiperidin-4-amine.
| Compound Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-1-cyclopropylpiperidin-4-amine |
|---|---|
| PubChem CID | 43791325 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N-[(4-chlorophenyl)-cyclopropylmethyl]-1-cyclopropylpiperidin-4-amine |
| SMILES | Clc1ccc(C(NC2CCN(C3CC3)CC2)C2CC2)cc1 |
| InChI | InChI=1S/C18H25ClN2/c19-15-5-3-14(4-6-15)18(13-1-2-13)20-16-9-11-21(12-10-16)17-7-8-17/h3-6,13,16-18,20H,1-2,7-12H2 |
| InChIKey | ACVPJVRWBGYFHA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |