C19H29ClN2 — CID 138057875
N-[1-(4-chlorophenyl)butan-2-yl]-1-cyclobutylpiperidin-4-amine (PubChem CID 138057875) has the molecular formula C19H29ClN2 and a molecular weight of 320.91 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)butan-2-yl]-1-cyclobutylpiperidin-4-amine.
| Compound Name | N-[1-(4-chlorophenyl)butan-2-yl]-1-cyclobutylpiperidin-4-amine |
|---|---|
| PubChem CID | 138057875 |
| Molecular Formula | C19H29ClN2 |
| Molecular Weight | 320.91 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-[1-(4-chlorophenyl)butan-2-yl]-1-cyclobutylpiperidin-4-amine |
| SMILES | CCC(Cc1ccc(Cl)cc1)NC1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C19H29ClN2/c1-2-17(14-15-6-8-16(20)9-7-15)21-18-10-12-22(13-11-18)19-4-3-5-19/h6-9,17-19,21H,2-5,10-14H2,1H3 |
| InChIKey | AOUJJFCDVCPVBX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.91 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |