C14H18N4O3 — CID 43783660
2-N,2-N-diethyl-5-N-[(5-nitrofuran-2-yl)methyl]pyridine-2,5-diamine (PubChem CID 43783660) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-N,2-N-diethyl-5-N-[(5-nitrofuran-2-yl)methyl]pyridine-2,5-diamine.
| Compound Name | 2-N,2-N-diethyl-5-N-[(5-nitrofuran-2-yl)methyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 43783660 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-N,2-N-diethyl-5-N-[(5-nitrofuran-2-yl)methyl]pyridine-2,5-diamine |
| SMILES | CCN(CC)c1ccc(NCc2ccc([N+](=O)[O-])o2)cn1 |
| InChI | InChI=1S/C14H18N4O3/c1-3-17(4-2)13-7-5-11(9-16-13)15-10-12-6-8-14(21-12)18(19)20/h5-9,15H,3-4,10H2,1-2H3 |
| InChIKey | OMYVDTGQAGOCOI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|