C20H29N — CID 43784498
1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(4-propan-2-ylphenyl)ethyl]ethanamine (PubChem CID 43784498) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(4-propan-2-ylphenyl)ethyl]ethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(4-propan-2-ylphenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 43784498 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(4-propan-2-ylphenyl)ethyl]ethanamine |
| SMILES | CC(C)c1ccc(C(C)NC(C)C2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C20H29N/c1-13(2)17-7-9-18(10-8-17)14(3)21-15(4)20-12-16-5-6-19(20)11-16/h5-10,13-16,19-21H,11-12H2,1-4H3 |
| InChIKey | CKILTEZXEIWMLE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|