C14H19N3O2 — CID 43786681
6-(hexan-2-ylamino)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 43786681) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-(hexan-2-ylamino)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(hexan-2-ylamino)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 43786681 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-(hexan-2-ylamino)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CCCCC(C)Nc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H19N3O2/c1-3-4-5-9(2)15-10-6-7-11-12(8-10)17-14(19)13(18)16-11/h6-9,15H,3-5H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | SZIXXOWHSTYWFK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|