C15H16INO — CID 43786897
1-cyclopropyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylmethanamine (PubChem CID 43786897) has the molecular formula C15H16INO and a molecular weight of 353.20 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylmethanamine.
| Compound Name | 1-cyclopropyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 43786897 |
| Molecular Formula | C15H16INO |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 1-cyclopropyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylmethanamine |
| SMILES | Ic1ccc(CNC(c2ccccc2)C2CC2)o1 |
| InChI | InChI=1S/C15H16INO/c16-14-9-8-13(18-14)10-17-15(12-6-7-12)11-4-2-1-3-5-11/h1-5,8-9,12,15,17H,6-7,10H2 |
| InChIKey | XCPOXKJYGFZNMD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|