C17H22INO — CID 43788951
2-ethyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylbutan-1-amine (PubChem CID 43788951) has the molecular formula C17H22INO and a molecular weight of 383.27 g/mol. Its IUPAC name is 2-ethyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylbutan-1-amine.
| Compound Name | 2-ethyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 43788951 |
| Molecular Formula | C17H22INO |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-ethyl-N-[(5-iodofuran-2-yl)methyl]-1-phenylbutan-1-amine |
| SMILES | CCC(CC)C(NCc1ccc(I)o1)c1ccccc1 |
| InChI | InChI=1S/C17H22INO/c1-3-13(4-2)17(14-8-6-5-7-9-14)19-12-15-10-11-16(18)20-15/h5-11,13,17,19H,3-4,12H2,1-2H3 |
| InChIKey | SUMGXTXSMXEEND-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|