C17H23IN2O — CID 43758958
N,N-diethyl-N'-[(5-iodofuran-2-yl)methyl]-1-phenylethane-1,2-diamine (PubChem CID 43758958) has the molecular formula C17H23IN2O and a molecular weight of 398.29 g/mol. Its IUPAC name is N,N-diethyl-N'-[(5-iodofuran-2-yl)methyl]-1-phenylethane-1,2-diamine.
| Compound Name | N,N-diethyl-N'-[(5-iodofuran-2-yl)methyl]-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 43758958 |
| Molecular Formula | C17H23IN2O |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N,N-diethyl-N'-[(5-iodofuran-2-yl)methyl]-1-phenylethane-1,2-diamine |
| SMILES | CCN(CC)C(CNCc1ccc(I)o1)c1ccccc1 |
| InChI | InChI=1S/C17H23IN2O/c1-3-20(4-2)16(14-8-6-5-7-9-14)13-19-12-15-10-11-17(18)21-15/h5-11,16,19H,3-4,12-13H2,1-2H3 |
| InChIKey | ZLBVBUWMPQWRSY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|