C12H21IN2O — CID 43763160
N',N'-diethyl-N-[(5-iodofuran-2-yl)methyl]propane-1,3-diamine (PubChem CID 43763160) has the molecular formula C12H21IN2O and a molecular weight of 336.22 g/mol. Its IUPAC name is N',N'-diethyl-N-[(5-iodofuran-2-yl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[(5-iodofuran-2-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 43763160 |
| Molecular Formula | C12H21IN2O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N',N'-diethyl-N-[(5-iodofuran-2-yl)methyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1ccc(I)o1 |
| InChI | InChI=1S/C12H21IN2O/c1-3-15(4-2)9-5-8-14-10-11-6-7-12(13)16-11/h6-7,14H,3-5,8-10H2,1-2H3 |
| InChIKey | VIQBJDVJSFVOEZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|