C14H20F3N — CID 43788016
N-[4-(trifluoromethyl)cyclohexyl]bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 43788016) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)cyclohexyl]bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-[4-(trifluoromethyl)cyclohexyl]bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 43788016 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-[4-(trifluoromethyl)cyclohexyl]bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | FC(F)(F)C1CCC(NC2CC3CC=CC32)CC1 |
| InChI | InChI=1S/C14H20F3N/c15-14(16,17)10-4-6-11(7-5-10)18-13-8-9-2-1-3-12(9)13/h1,3,9-13,18H,2,4-8H2 |
| InChIKey | MBCNMXQTZVGYQS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|