C14H21F3N2 — CID 60856330
N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 60856330) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 60856330 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | FC(F)(F)CN1CCC(CNC2CC3CC=CC32)C1 |
| InChI | InChI=1S/C14H21F3N2/c15-14(16,17)9-19-5-4-10(8-19)7-18-13-6-11-2-1-3-12(11)13/h1,3,10-13,18H,2,4-9H2 |
| InChIKey | FSZWHYLIWGXROQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|